C16H28N2O — CID 144922631
N-(cyclohexa-1,5-dien-1-ylmethyl)-1-(3-methoxypropyl)piperidin-4-amine (PubChem CID 144922631) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-1-(3-methoxypropyl)piperidin-4-amine.
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-1-(3-methoxypropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 144922631 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-1-(3-methoxypropyl)piperidin-4-amine |
| SMILES | COCCCN1CCC(NCC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C16H28N2O/c1-19-13-5-10-18-11-8-16(9-12-18)17-14-15-6-3-2-4-7-15/h3,6-7,16-17H,2,4-5,8-14H2,1H3 |
| InChIKey | NLQGUQJMVUQAPM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|