About 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine
5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine (PubChem CID 18785556) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine.
Molecular Properties
| Compound Name | 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine |
| PubChem CID | 18785556 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine |
| SMILES | C1=CC2=c3ccccc3=CON(C3CCNCC3)C2C=C1 |
| InChI | InChI=1S/C18H20N2O/c1-2-6-16-14(5-1)13-21-20(15-9-11-19-12-10-15)18-8-4-3-7-17(16)18/h1-8,13,15,18-19H,9-12H2 |
| InChIKey | MJXLMLYVVVBFEG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine?
The IUPAC name of 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine (CID 18785556) is 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine.
What is the SMILES notation for 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine?
The canonical SMILES for 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine is C1=CC2=c3ccccc3=CON(C3CCNCC3)C2C=C1.
What is the InChIKey of 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine?
The InChIKey is MJXLMLYVVVBFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O/c1-2-6-16-14(5-1)13-21-20(15-9-11-19-12-10-15)18-8-4-3-7-17(16)18/h1-8,13,15,18-19H,9-12H2.
What are the key properties of 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine?
5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine has a molecular weight of 280.37 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-4-yl-4aH-benzo[d][2,3]benzoxazepine is sourced from PubChem (CID 18785556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).