C11H20NO+ — CID 3306152
5-methyl-1-(oxan-4-yl)-1,2,3,6-tetrahydropyridin-1-ium (PubChem CID 3306152) has the molecular formula C11H20NO+ and a molecular weight of 182.29 g/mol. Its IUPAC name is 5-methyl-1-(oxan-4-yl)-1,2,3,6-tetrahydropyridin-1-ium.
| Compound Name | 5-methyl-1-(oxan-4-yl)-1,2,3,6-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 3306152 |
| Molecular Formula | C11H20NO+ |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 5-methyl-1-(oxan-4-yl)-1,2,3,6-tetrahydropyridin-1-ium |
| SMILES | CC1=CCC[NH+](C2CCOCC2)C1 |
| InChI | InChI=1S/C11H19NO/c1-10-3-2-6-12(9-10)11-4-7-13-8-5-11/h3,11H,2,4-9H2,1H3/p+1 |
| InChIKey | MJUFEWVAXVHWSX-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|