C14H26N2O — CID 142345328
1,5-dimethyl-N-(oxan-4-yl)-2H-pyridin-3-amine;ethane (PubChem CID 142345328) has the molecular formula C14H26N2O and a molecular weight of 238.38 g/mol. Its IUPAC name is 1,5-dimethyl-N-(oxan-4-yl)-2H-pyridin-3-amine;ethane.
| Compound Name | 1,5-dimethyl-N-(oxan-4-yl)-2H-pyridin-3-amine;ethane |
|---|---|
| PubChem CID | 142345328 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1,5-dimethyl-N-(oxan-4-yl)-2H-pyridin-3-amine;ethane |
| SMILES | CC.CC1=CN(C)CC(NC2CCOCC2)=C1 |
| InChI | InChI=1S/C12H20N2O.C2H6/c1-10-7-12(9-14(2)8-10)13-11-3-5-15-6-4-11;1-2/h7-8,11,13H,3-6,9H2,1-2H3;1-2H3 |
| InChIKey | KWTWKWKDJDOWKF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |