C13H22N2O — CID 170054399
(1E,4Z)-6-methyl-1-N-(oxan-4-yl)hepta-1,4,6-triene-1,4-diamine (PubChem CID 170054399) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (1E,4Z)-6-methyl-1-N-(oxan-4-yl)hepta-1,4,6-triene-1,4-diamine.
| Compound Name | (1E,4Z)-6-methyl-1-N-(oxan-4-yl)hepta-1,4,6-triene-1,4-diamine |
|---|---|
| PubChem CID | 170054399 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (1E,4Z)-6-methyl-1-N-(oxan-4-yl)hepta-1,4,6-triene-1,4-diamine |
| SMILES | C=C(C)/C=C(\N)C/C=C/NC1CCOCC1 |
| InChI | InChI=1S/C13H22N2O/c1-11(2)10-12(14)4-3-7-15-13-5-8-16-9-6-13/h3,7,10,13,15H,1,4-6,8-9,14H2,2H3/b7-3+,12-10- |
| InChIKey | BLVZYQUSRNCQEC-PCKGFSEESA-N |
| XLogP | 2.08 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|