C13H24N2O — CID 142345300
ethane;5-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-3-amine (PubChem CID 142345300) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is ethane;5-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-3-amine.
| Compound Name | ethane;5-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 142345300 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | ethane;5-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-3-amine |
| SMILES | CC.CC1=CNCC(NC2CCOCC2)=C1 |
| InChI | InChI=1S/C11H18N2O.C2H6/c1-9-6-11(8-12-7-9)13-10-2-4-14-5-3-10;1-2/h6-7,10,12-13H,2-5,8H2,1H3;1-2H3 |
| InChIKey | NEFGOBZUXZWEBM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |