C11H18N2O — CID 142345301
5-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-3-amine (PubChem CID 142345301) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 5-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-3-amine.
| Compound Name | 5-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 142345301 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 5-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-3-amine |
| SMILES | CC1=CNCC(NC2CCOCC2)=C1 |
| InChI | InChI=1S/C11H18N2O/c1-9-6-11(8-12-7-9)13-10-2-4-14-5-3-10/h6-7,10,12-13H,2-5,8H2,1H3 |
| InChIKey | OTRUYYQYKYNFHO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |