C18H30N2O — CID 176921934
N-[(2Z,4Z)-4-(2,3,6,7-tetrahydro-1H-azepin-4-ylmethyl)hexa-2,4-dien-2-yl]oxan-4-amine (PubChem CID 176921934) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-[(2Z,4Z)-4-(2,3,6,7-tetrahydro-1H-azepin-4-ylmethyl)hexa-2,4-dien-2-yl]oxan-4-amine.
| Compound Name | N-[(2Z,4Z)-4-(2,3,6,7-tetrahydro-1H-azepin-4-ylmethyl)hexa-2,4-dien-2-yl]oxan-4-amine |
|---|---|
| PubChem CID | 176921934 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-[(2Z,4Z)-4-(2,3,6,7-tetrahydro-1H-azepin-4-ylmethyl)hexa-2,4-dien-2-yl]oxan-4-amine |
| SMILES | C/C=C(\C=C(\C)NC1CCOCC1)CC1=CCCNCC1 |
| InChI | InChI=1S/C18H30N2O/c1-3-16(14-17-5-4-9-19-10-6-17)13-15(2)20-18-7-11-21-12-8-18/h3,5,13,18-20H,4,6-12,14H2,1-2H3/b15-13-,16-3+ |
| InChIKey | VQZLGJAWQPHORZ-WGFKILHBSA-N |
| XLogP | 3.31 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|