C11H18N2O — CID 86341860
N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-4-amine (PubChem CID 86341860) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-4-amine.
| Compound Name | N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-4-amine |
|---|---|
| PubChem CID | 86341860 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-4-amine |
| SMILES | CN(C1=CCNC=C1)C1CCOCC1 |
| InChI | InChI=1S/C11H18N2O/c1-13(10-2-6-12-7-3-10)11-4-8-14-9-5-11/h2-3,6,11-12H,4-5,7-9H2,1H3 |
| InChIKey | CHIJAHMFZBNQFG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |