C15H30N2OU — CID 143375653
3-N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-N-ethyl-1-N-methylbutane-1,3-diamine;uranium (PubChem CID 143375653) has the molecular formula C15H30N2OU and a molecular weight of 492.45 g/mol. Its IUPAC name is 3-N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-N-ethyl-1-N-methylbutane-1,3-diamine;uranium.
| Compound Name | 3-N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-N-ethyl-1-N-methylbutane-1,3-diamine;uranium |
|---|---|
| PubChem CID | 143375653 |
| Molecular Formula | C15H30N2OU |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 3-N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-N-ethyl-1-N-methylbutane-1,3-diamine;uranium |
| SMILES | C=C(/C=C(\C)OCC)CNC(C)CCN(C)CC.[U] |
| InChI | InChI=1S/C15H30N2O.U/c1-7-17(6)10-9-14(4)16-12-13(3)11-15(5)18-8-2;/h11,14,16H,3,7-10,12H2,1-2,4-6H3;/b15-11+; |
| InChIKey | CYQUZWRXJHCPMB-KRWCAOSLSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|