C10H5BrF3N3O3 — CID 170750246
4-bromo-1-(2,2-difluoroethyl)-3-fluoro-6-nitroindazole-5-carbaldehyde (PubChem CID 170750246) has the molecular formula C10H5BrF3N3O3 and a molecular weight of 352.07 g/mol. Its IUPAC name is 4-bromo-1-(2,2-difluoroethyl)-3-fluoro-6-nitroindazole-5-carbaldehyde.
| Compound Name | 4-bromo-1-(2,2-difluoroethyl)-3-fluoro-6-nitroindazole-5-carbaldehyde |
|---|---|
| PubChem CID | 170750246 |
| Molecular Formula | C10H5BrF3N3O3 |
| Molecular Weight | 352.07 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 4-bromo-1-(2,2-difluoroethyl)-3-fluoro-6-nitroindazole-5-carbaldehyde |
| SMILES | O=Cc1c([N+](=O)[O-])cc2c(c(F)nn2CC(F)F)c1Br |
| InChI | InChI=1S/C10H5BrF3N3O3/c11-9-4(3-18)5(17(19)20)1-6-8(9)10(14)15-16(6)2-7(12)13/h1,3,7H,2H2 |
| InChIKey | OSCPUFQOCBPGPA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.07 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|