C19H15F3N2O5 — CID 170751205
1-[3-[(1S)-1-amino-2-carboxyethyl]phenyl]-6-(trifluoromethoxy)indole-2-carboxylic acid (PubChem CID 170751205) has the molecular formula C19H15F3N2O5 and a molecular weight of 408.33 g/mol. Its IUPAC name is 1-[3-[(1S)-1-amino-2-carboxyethyl]phenyl]-6-(trifluoromethoxy)indole-2-carboxylic acid.
| Compound Name | 1-[3-[(1S)-1-amino-2-carboxyethyl]phenyl]-6-(trifluoromethoxy)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170751205 |
| Molecular Formula | C19H15F3N2O5 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[3-[(1S)-1-amino-2-carboxyethyl]phenyl]-6-(trifluoromethoxy)indole-2-carboxylic acid |
| SMILES | N[C@@H](CC(=O)O)c1cccc(-n2c(C(=O)O)cc3ccc(OC(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C19H15F3N2O5/c20-19(21,22)29-13-5-4-11-7-16(18(27)28)24(15(11)8-13)12-3-1-2-10(6-12)14(23)9-17(25)26/h1-8,14H,9,23H2,(H,25,26)(H,27,28)/t14-/m0/s1 |
| InChIKey | NVSRTJSRYTUTKQ-AWEZNQCLSA-N |
| XLogP | 3.70 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |