C23H23F3N2O4 — CID 170751429
tert-butyl 3-[3-[2-carbamoyl-6-(trifluoromethoxy)indol-1-yl]phenyl]propanoate (PubChem CID 170751429) has the molecular formula C23H23F3N2O4 and a molecular weight of 448.44 g/mol. Its IUPAC name is tert-butyl 3-[3-[2-carbamoyl-6-(trifluoromethoxy)indol-1-yl]phenyl]propanoate.
| Compound Name | tert-butyl 3-[3-[2-carbamoyl-6-(trifluoromethoxy)indol-1-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 170751429 |
| Molecular Formula | C23H23F3N2O4 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | tert-butyl 3-[3-[2-carbamoyl-6-(trifluoromethoxy)indol-1-yl]phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cccc(-n2c(C(N)=O)cc3ccc(OC(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C23H23F3N2O4/c1-22(2,3)32-20(29)10-7-14-5-4-6-16(11-14)28-18-13-17(31-23(24,25)26)9-8-15(18)12-19(28)21(27)30/h4-6,8-9,11-13H,7,10H2,1-3H3,(H2,27,30) |
| InChIKey | WDDCTWMBZMMGEH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |