C18H15F3N4O2 — CID 170751260
1-[6-(azetidin-1-yl)-2-pyridinyl]-6-(trifluoromethoxy)indole-2-carboxamide (PubChem CID 170751260) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is 1-[6-(azetidin-1-yl)-2-pyridinyl]-6-(trifluoromethoxy)indole-2-carboxamide.
| Compound Name | 1-[6-(azetidin-1-yl)-2-pyridinyl]-6-(trifluoromethoxy)indole-2-carboxamide |
|---|---|
| PubChem CID | 170751260 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-[6-(azetidin-1-yl)-2-pyridinyl]-6-(trifluoromethoxy)indole-2-carboxamide |
| SMILES | NC(=O)c1cc2ccc(OC(F)(F)F)cc2n1-c1cccc(N2CCC2)n1 |
| InChI | InChI=1S/C18H15F3N4O2/c19-18(20,21)27-12-6-5-11-9-14(17(22)26)25(13(11)10-12)16-4-1-3-15(23-16)24-7-2-8-24/h1,3-6,9-10H,2,7-8H2,(H2,22,26) |
| InChIKey | VLGFQRKAZXSJDW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |