C22H23ClN4O4 — CID 170753493
2-[1-(6-chloro-3-methyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylamino]benzoic acid (PubChem CID 170753493) has the molecular formula C22H23ClN4O4 and a molecular weight of 442.90 g/mol. Its IUPAC name is 2-[1-(6-chloro-3-methyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylamino]benzoic acid.
| Compound Name | 2-[1-(6-chloro-3-methyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 170753493 |
| Molecular Formula | C22H23ClN4O4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[1-(6-chloro-3-methyl-2-morpholin-4-yl-4-oxoquinazolin-8-yl)ethylamino]benzoic acid |
| SMILES | CC(Nc1ccccc1C(=O)O)c1cc(Cl)cc2c(=O)n(C)c(N3CCOCC3)nc12 |
| InChI | InChI=1S/C22H23ClN4O4/c1-13(24-18-6-4-3-5-15(18)21(29)30)16-11-14(23)12-17-19(16)25-22(26(2)20(17)28)27-7-9-31-10-8-27/h3-6,11-13,24H,7-10H2,1-2H3,(H,29,30) |
| InChIKey | AVRCQJNPPIKTRQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |