C23H21ClN4O3 — CID 175992727
2-[[(1R)-1-(6-chloro-4-cyano-2-morpholin-4-ylquinolin-8-yl)ethyl]amino]benzoic acid (PubChem CID 175992727) has the molecular formula C23H21ClN4O3 and a molecular weight of 436.90 g/mol. Its IUPAC name is 2-[[(1R)-1-(6-chloro-4-cyano-2-morpholin-4-ylquinolin-8-yl)ethyl]amino]benzoic acid.
| Compound Name | 2-[[(1R)-1-(6-chloro-4-cyano-2-morpholin-4-ylquinolin-8-yl)ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175992727 |
| Molecular Formula | C23H21ClN4O3 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[[(1R)-1-(6-chloro-4-cyano-2-morpholin-4-ylquinolin-8-yl)ethyl]amino]benzoic acid |
| SMILES | C[C@@H](Nc1ccccc1C(=O)O)c1cc(Cl)cc2c(C#N)cc(N3CCOCC3)nc12 |
| InChI | InChI=1S/C23H21ClN4O3/c1-14(26-20-5-3-2-4-17(20)23(29)30)18-11-16(24)12-19-15(13-25)10-21(27-22(18)19)28-6-8-31-9-7-28/h2-5,10-12,14,26H,6-9H2,1H3,(H,29,30)/t14-/m1/s1 |
| InChIKey | MKZLXCDVQLZKPL-CQSZACIVSA-N |
| XLogP | 4.47 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |