C25H25N3O3 — CID 171520467
2-[[(1R)-1-[3-cyano-6-methyl-2-(oxan-4-yl)quinolin-8-yl]ethyl]amino]benzoic acid (PubChem CID 171520467) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[[(1R)-1-[3-cyano-6-methyl-2-(oxan-4-yl)quinolin-8-yl]ethyl]amino]benzoic acid.
| Compound Name | 2-[[(1R)-1-[3-cyano-6-methyl-2-(oxan-4-yl)quinolin-8-yl]ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 171520467 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[[(1R)-1-[3-cyano-6-methyl-2-(oxan-4-yl)quinolin-8-yl]ethyl]amino]benzoic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccccc2C(=O)O)c2nc(C3CCOCC3)c(C#N)cc2c1 |
| InChI | InChI=1S/C25H25N3O3/c1-15-11-18-13-19(14-26)23(17-7-9-31-10-8-17)28-24(18)21(12-15)16(2)27-22-6-4-3-5-20(22)25(29)30/h3-6,11-13,16-17,27H,7-10H2,1-2H3,(H,29,30)/t16-/m1/s1 |
| InChIKey | JPLMXFSZYRQROM-MRXNPFEDSA-N |
| XLogP | 5.18 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |