C24H25ClN2O3 — CID 177167676
2-[[(1S)-1-[2-chloro-7-methyl-3-(oxan-4-yl)quinolin-5-yl]ethyl]amino]benzoic acid (PubChem CID 177167676) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is 2-[[(1S)-1-[2-chloro-7-methyl-3-(oxan-4-yl)quinolin-5-yl]ethyl]amino]benzoic acid.
| Compound Name | 2-[[(1S)-1-[2-chloro-7-methyl-3-(oxan-4-yl)quinolin-5-yl]ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 177167676 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[[(1S)-1-[2-chloro-7-methyl-3-(oxan-4-yl)quinolin-5-yl]ethyl]amino]benzoic acid |
| SMILES | Cc1cc([C@H](C)Nc2ccccc2C(=O)O)c2cc(C3CCOCC3)c(Cl)nc2c1 |
| InChI | InChI=1S/C24H25ClN2O3/c1-14-11-18(15(2)26-21-6-4-3-5-17(21)24(28)29)20-13-19(16-7-9-30-10-8-16)23(25)27-22(20)12-14/h3-6,11-13,15-16,26H,7-10H2,1-2H3,(H,28,29)/t15-/m0/s1 |
| InChIKey | IEQMFGSADWDTHS-HNNXBMFYSA-N |
| XLogP | 5.96 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|