C25H26N4O2 — CID 175992682
2-[[(1R)-1-(4-cyano-6-methyl-2-piperidin-1-ylquinolin-8-yl)ethyl]amino]benzoic acid (PubChem CID 175992682) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[[(1R)-1-(4-cyano-6-methyl-2-piperidin-1-ylquinolin-8-yl)ethyl]amino]benzoic acid.
| Compound Name | 2-[[(1R)-1-(4-cyano-6-methyl-2-piperidin-1-ylquinolin-8-yl)ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175992682 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-[[(1R)-1-(4-cyano-6-methyl-2-piperidin-1-ylquinolin-8-yl)ethyl]amino]benzoic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccccc2C(=O)O)c2nc(N3CCCCC3)cc(C#N)c2c1 |
| InChI | InChI=1S/C25H26N4O2/c1-16-12-20(17(2)27-22-9-5-4-8-19(22)25(30)31)24-21(13-16)18(15-26)14-23(28-24)29-10-6-3-7-11-29/h4-5,8-9,12-14,17,27H,3,6-7,10-11H2,1-2H3,(H,30,31)/t17-/m1/s1 |
| InChIKey | LDUNULJYYMGLOI-QGZVFWFLSA-N |
| XLogP | 5.28 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |