C9H5Cl2IN2O — CID 170754008
2,5-dichloro-8-iodo-3-methylquinazolin-4-one (PubChem CID 170754008) has the molecular formula C9H5Cl2IN2O and a molecular weight of 354.96 g/mol. Its IUPAC name is 2,5-dichloro-8-iodo-3-methylquinazolin-4-one.
| Compound Name | 2,5-dichloro-8-iodo-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 170754008 |
| Molecular Formula | C9H5Cl2IN2O |
| Molecular Weight | 354.96 g/mol |
| Exact Mass | 353.88 |
| IUPAC Name | 2,5-dichloro-8-iodo-3-methylquinazolin-4-one |
| SMILES | Cn1c(Cl)nc2c(I)ccc(Cl)c2c1=O |
| InChI | InChI=1S/C9H5Cl2IN2O/c1-14-8(15)6-4(10)2-3-5(12)7(6)13-9(14)11/h2-3H,1H3 |
| InChIKey | MUYPGDNMABOLSM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.96 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|