C10H10BrFN2 — CID 170754419
3-(4-bromo-3-fluorophenyl)-2-(methylamino)propanenitrile (PubChem CID 170754419) has the molecular formula C10H10BrFN2 and a molecular weight of 257.11 g/mol. Its IUPAC name is 3-(4-bromo-3-fluorophenyl)-2-(methylamino)propanenitrile.
| Compound Name | 3-(4-bromo-3-fluorophenyl)-2-(methylamino)propanenitrile |
|---|---|
| PubChem CID | 170754419 |
| Molecular Formula | C10H10BrFN2 |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 3-(4-bromo-3-fluorophenyl)-2-(methylamino)propanenitrile |
| SMILES | CNC(C#N)Cc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C10H10BrFN2/c1-14-8(6-13)4-7-2-3-9(11)10(12)5-7/h2-3,5,8,14H,4H2,1H3 |
| InChIKey | KUPPKJNOAVJXSO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |