C12H14BrFN2 — CID 81436828
3-[(4-bromo-3-fluorophenyl)methylamino]pentanenitrile (PubChem CID 81436828) has the molecular formula C12H14BrFN2 and a molecular weight of 285.16 g/mol. Its IUPAC name is 3-[(4-bromo-3-fluorophenyl)methylamino]pentanenitrile.
| Compound Name | 3-[(4-bromo-3-fluorophenyl)methylamino]pentanenitrile |
|---|---|
| PubChem CID | 81436828 |
| Molecular Formula | C12H14BrFN2 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 3-[(4-bromo-3-fluorophenyl)methylamino]pentanenitrile |
| SMILES | CCC(CC#N)NCc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H14BrFN2/c1-2-10(5-6-15)16-8-9-3-4-11(13)12(14)7-9/h3-4,7,10,16H,2,5,8H2,1H3 |
| InChIKey | NIRCQKTVWMPJDP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |