C13H16F2N2 — CID 113328347
3-[[4-(difluoromethyl)phenyl]methylamino]pentanenitrile (PubChem CID 113328347) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is 3-[[4-(difluoromethyl)phenyl]methylamino]pentanenitrile.
| Compound Name | 3-[[4-(difluoromethyl)phenyl]methylamino]pentanenitrile |
|---|---|
| PubChem CID | 113328347 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 3-[[4-(difluoromethyl)phenyl]methylamino]pentanenitrile |
| SMILES | CCC(CC#N)NCc1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C13H16F2N2/c1-2-12(7-8-16)17-9-10-3-5-11(6-4-10)13(14)15/h3-6,12-13,17H,2,7,9H2,1H3 |
| InChIKey | PAULVMZAZTYLGN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |