C16H17FN2S — CID 62646412
3-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]pentanenitrile (PubChem CID 62646412) has the molecular formula C16H17FN2S and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]pentanenitrile.
| Compound Name | 3-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]pentanenitrile |
|---|---|
| PubChem CID | 62646412 |
| Molecular Formula | C16H17FN2S |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-[(4-fluoro-3-thiophen-2-ylphenyl)methylamino]pentanenitrile |
| SMILES | CCC(CC#N)NCc1ccc(F)c(-c2cccs2)c1 |
| InChI | InChI=1S/C16H17FN2S/c1-2-13(7-8-18)19-11-12-5-6-15(17)14(10-12)16-4-3-9-20-16/h3-6,9-10,13,19H,2,7,11H2,1H3 |
| InChIKey | XCZNXZXFNKBJGF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |