C12H19N3 — CID 66416364
3-[(1-ethylpyrrol-3-yl)methylamino]pentanenitrile (PubChem CID 66416364) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-[(1-ethylpyrrol-3-yl)methylamino]pentanenitrile.
| Compound Name | 3-[(1-ethylpyrrol-3-yl)methylamino]pentanenitrile |
|---|---|
| PubChem CID | 66416364 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-[(1-ethylpyrrol-3-yl)methylamino]pentanenitrile |
| SMILES | CCC(CC#N)NCc1ccn(CC)c1 |
| InChI | InChI=1S/C12H19N3/c1-3-12(5-7-13)14-9-11-6-8-15(4-2)10-11/h6,8,10,12,14H,3-5,9H2,1-2H3 |
| InChIKey | UQQWDVSBJSOPDG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |