C14H26N2 — CID 66413834
3-ethyl-N-[(1-ethylpyrrol-3-yl)methyl]pentan-2-amine (PubChem CID 66413834) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 3-ethyl-N-[(1-ethylpyrrol-3-yl)methyl]pentan-2-amine.
| Compound Name | 3-ethyl-N-[(1-ethylpyrrol-3-yl)methyl]pentan-2-amine |
|---|---|
| PubChem CID | 66413834 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 3-ethyl-N-[(1-ethylpyrrol-3-yl)methyl]pentan-2-amine |
| SMILES | CCC(CC)C(C)NCc1ccn(CC)c1 |
| InChI | InChI=1S/C14H26N2/c1-5-14(6-2)12(4)15-10-13-8-9-16(7-3)11-13/h8-9,11-12,14-15H,5-7,10H2,1-4H3 |
| InChIKey | QEODDKOWYROASP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |