C13H17BrN2O2 — CID 62646746
3-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylamino]pentanenitrile (PubChem CID 62646746) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.20 g/mol. Its IUPAC name is 3-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylamino]pentanenitrile.
| Compound Name | 3-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylamino]pentanenitrile |
|---|---|
| PubChem CID | 62646746 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 3-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylamino]pentanenitrile |
| SMILES | CCC(CC#N)NCc1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-3-10(4-5-15)16-8-9-6-11(14)13(17)12(7-9)18-2/h6-7,10,16-17H,3-4,8H2,1-2H3 |
| InChIKey | IIWKGLLBUOWCFL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |