C27H31N4O6SSi — CID 170754682
CID 170754682 (PubChem CID 170754682) has the molecular formula C27H31N4O6SSi and a molecular weight of 567.72 g/mol.
| Compound Name | CID 170754682 |
|---|---|
| PubChem CID | 170754682 |
| Molecular Formula | C27H31N4O6SSi |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | — |
| SMILES | Cn1c(=O)oc2ccc(-c3ccc(C[C@@H](C#N)NC(=O)CN(C(=O)OC(C)(C)C)[C@H]4COC[C@H]4C[Si])s3)cc21 |
| InChI | InChI=1S/C27H31N4O6SSi/c1-27(2,3)37-26(34)31(21-14-35-13-17(21)15-39)12-24(32)29-18(11-28)10-19-6-8-23(38-19)16-5-7-22-20(9-16)30(4)25(33)36-22/h5-9,17-18,21H,10,12-15H2,1-4H3,(H,29,32)/t17-,18-,21-/m0/s1 |
| InChIKey | OXYCTYUQTBZGCK-WFXMLNOXSA-N |
| XLogP | 3.25 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|