C57H119N5O4 — CID 170754819
2-[2-[di(nonyl)amino]ethyl-nonylamino]acetaldehyde;[2-methyl-3-(nonylamino)propyl] hexanoate;N-[2-[methyl(propyl)amino]ethyl]formamide (PubChem CID 170754819) has the molecular formula C57H119N5O4 and a molecular weight of 938.61 g/mol. Its IUPAC name is 2-[2-[di(nonyl)amino]ethyl-nonylamino]acetaldehyde;[2-methyl-3-(nonylamino)propyl] hexanoate;N-[2-[methyl(propyl)amino]ethyl]formamide.
| Compound Name | 2-[2-[di(nonyl)amino]ethyl-nonylamino]acetaldehyde;[2-methyl-3-(nonylamino)propyl] hexanoate;N-[2-[methyl(propyl)amino]ethyl]formamide |
|---|---|
| PubChem CID | 170754819 |
| Molecular Formula | C57H119N5O4 |
| Molecular Weight | 938.61 g/mol |
| Exact Mass | 937.93 |
| IUPAC Name | 2-[2-[di(nonyl)amino]ethyl-nonylamino]acetaldehyde;[2-methyl-3-(nonylamino)propyl] hexanoate;N-[2-[methyl(propyl)amino]ethyl]formamide |
| SMILES | CCCCCCCCCN(CC=O)CCN(CCCCCCCCC)CCCCCCCCC.CCCCCCCCCNCC(C)COC(=O)CCCCC.CCCN(C)CCNC=O |
| InChI | InChI=1S/C31H64N2O.C19H39NO2.C7H16N2O/c1-4-7-10-13-16-19-22-25-32(26-23-20-17-14-11-8-5-2)28-29-33(30-31-34)27-24-21-18-15-12-9-6-3;1-4-6-8-9-10-11-13-15-20-16-18(3)17-22-19(21)14-12-7-5-2;1-3-5-9(2)6-4-8-7-10/h31H,4-30H2,1-3H3;18,20H,4-17H2,1-3H3;7H,3-6H2,1-2H3,(H,8,10) |
| InChIKey | ZWCQXZLIEIXQED-UHFFFAOYSA-N |
| XLogP | 14.20 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.61 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|