C35H70N2O5 — CID 175392355
6-[2-hydroxyethyl-[3-[[6-(2-octyldecoxy)-6-oxohexyl]amino]propyl]amino]hexanoic acid (PubChem CID 175392355) has the molecular formula C35H70N2O5 and a molecular weight of 598.95 g/mol. Its IUPAC name is 6-[2-hydroxyethyl-[3-[[6-(2-octyldecoxy)-6-oxohexyl]amino]propyl]amino]hexanoic acid.
| Compound Name | 6-[2-hydroxyethyl-[3-[[6-(2-octyldecoxy)-6-oxohexyl]amino]propyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175392355 |
| Molecular Formula | C35H70N2O5 |
| Molecular Weight | 598.95 g/mol |
| Exact Mass | 598.53 |
| IUPAC Name | 6-[2-hydroxyethyl-[3-[[6-(2-octyldecoxy)-6-oxohexyl]amino]propyl]amino]hexanoic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)COC(=O)CCCCCNCCCN(CCO)CCCCCC(=O)O |
| InChI | InChI=1S/C35H70N2O5/c1-3-5-7-9-11-15-22-33(23-16-12-10-8-6-4-2)32-42-35(41)25-18-13-19-26-36-27-21-29-37(30-31-38)28-20-14-17-24-34(39)40/h33,36,38H,3-32H2,1-2H3,(H,39,40) |
| InChIKey | XXCRFUCDBWCHDF-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.95 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|