About 7-propa-1,2-dienoxypentadecane
7-propa-1,2-dienoxypentadecane (PubChem CID 170755177) has the molecular formula C18H34O
and a molecular weight of 266.47 g/mol. Its IUPAC name is 7-propa-1,2-dienoxypentadecane.
Molecular Properties
| Compound Name | 7-propa-1,2-dienoxypentadecane |
| PubChem CID | 170755177 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | 7-propa-1,2-dienoxypentadecane |
| SMILES | C=C=COC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C18H34O/c1-4-7-9-11-12-14-16-18(19-17-6-3)15-13-10-8-5-2/h17-18H,3-5,7-16H2,1-2H3 |
| InChIKey | HWTNURQMUSROQK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-propa-1,2-dienoxypentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propa-1,2-dienoxypentadecane?
The IUPAC name of 7-propa-1,2-dienoxypentadecane (CID 170755177) is 7-propa-1,2-dienoxypentadecane.
What is the SMILES notation for 7-propa-1,2-dienoxypentadecane?
The canonical SMILES for 7-propa-1,2-dienoxypentadecane is C=C=COC(CCCCCC)CCCCCCCC.
What is the InChIKey of 7-propa-1,2-dienoxypentadecane?
The InChIKey is HWTNURQMUSROQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O/c1-4-7-9-11-12-14-16-18(19-17-6-3)15-13-10-8-5-2/h17-18H,3-5,7-16H2,1-2H3.
What are the key properties of 7-propa-1,2-dienoxypentadecane?
7-propa-1,2-dienoxypentadecane has a molecular weight of 266.47 g/mol, XLogP of 6.39, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propa-1,2-dienoxypentadecane is sourced from PubChem (CID 170755177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).