C15H20N6O — CID 170755771
N,N'-diamino-4-[[4-(2-methylpropanoyl)pyrazol-1-yl]methyl]benzenecarboximidamide (PubChem CID 170755771) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is N,N'-diamino-4-[[4-(2-methylpropanoyl)pyrazol-1-yl]methyl]benzenecarboximidamide.
| Compound Name | N,N'-diamino-4-[[4-(2-methylpropanoyl)pyrazol-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 170755771 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N,N'-diamino-4-[[4-(2-methylpropanoyl)pyrazol-1-yl]methyl]benzenecarboximidamide |
| SMILES | CC(C)C(=O)c1cnn(Cc2ccc(/C(=N/N)NN)cc2)c1 |
| InChI | InChI=1S/C15H20N6O/c1-10(2)14(22)13-7-18-21(9-13)8-11-3-5-12(6-4-11)15(19-16)20-17/h3-7,9-10H,8,16-17H2,1-2H3,(H,19,20) |
| InChIKey | QQNQAQUQJZKMAD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|