methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate

C14H15ClO3 — CID 170755786

IUPACmethyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate
SMILESCOC(=O)Cc1ccc(C2=CCOCC2)c(Cl)c1
InChIInChI=1S/C14H15ClO3/c1-17-14(16)9-10-2-3-12(13(15)8-10)11-4-6-18-7-5-11/h2-4,8H,5-7,9H2,1H3
InChIKeyDVKHEBXFAWTZMF-UHFFFAOYSA-N
MW266.72 g/mol
LogP2.86
Rot. Bonds3

About methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate

methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate (PubChem CID 170755786) has the molecular formula C14H15ClO3 and a molecular weight of 266.72 g/mol. Its IUPAC name is methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate.

Molecular Properties

Compound Namemethyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate
PubChem CID170755786
Molecular FormulaC14H15ClO3
Molecular Weight266.72 g/mol
Exact Mass266.07
IUPAC Namemethyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate
SMILESCOC(=O)Cc1ccc(C2=CCOCC2)c(Cl)c1
InChIInChI=1S/C14H15ClO3/c1-17-14(16)9-10-2-3-12(13(15)8-10)11-4-6-18-7-5-11/h2-4,8H,5-7,9H2,1H3
InChIKeyDVKHEBXFAWTZMF-UHFFFAOYSA-N
XLogP2.86
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.72
LogP ≤ 52.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate?
The IUPAC name of methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate (CID 170755786) is methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate.
What is the SMILES notation for methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate?
The canonical SMILES for methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate is COC(=O)Cc1ccc(C2=CCOCC2)c(Cl)c1.
What is the InChIKey of methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate?
The InChIKey is DVKHEBXFAWTZMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClO3/c1-17-14(16)9-10-2-3-12(13(15)8-10)11-4-6-18-7-5-11/h2-4,8H,5-7,9H2,1H3.
What are the key properties of methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate?
methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate has a molecular weight of 266.72 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-chloro-4-(3,6-dihydro-2H-pyran-4-yl)phenyl]acetate is sourced from PubChem (CID 170755786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).