C34H40ClN7O2 — CID 170755805
(1-benzylpyrazol-4-yl)-[8-[5-[(3-chloro-4-methylphenyl)methyl]-1H-1,2,4-triazol-3-yl]-2-methyl-2,6-diazaspiro[3.4]octan-6-yl]methanone;2,2-dimethylcyclopropane-1-carbaldehyde (PubChem CID 170755805) has the molecular formula C34H40ClN7O2 and a molecular weight of 614.19 g/mol. Its IUPAC name is (1-benzylpyrazol-4-yl)-[8-[5-[(3-chloro-4-methylphenyl)methyl]-1H-1,2,4-triazol-3-yl]-2-methyl-2,6-diazaspiro[3.4]octan-6-yl]methanone;2,2-dimethylcyclopropane-1-carbaldehyde.
| Compound Name | (1-benzylpyrazol-4-yl)-[8-[5-[(3-chloro-4-methylphenyl)methyl]-1H-1,2,4-triazol-3-yl]-2-methyl-2,6-diazaspiro[3.4]octan-6-yl]methanone;2,2-dimethylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 170755805 |
| Molecular Formula | C34H40ClN7O2 |
| Molecular Weight | 614.19 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | (1-benzylpyrazol-4-yl)-[8-[5-[(3-chloro-4-methylphenyl)methyl]-1H-1,2,4-triazol-3-yl]-2-methyl-2,6-diazaspiro[3.4]octan-6-yl]methanone;2,2-dimethylcyclopropane-1-carbaldehyde |
| SMILES | CC1(C)CC1C=O.Cc1ccc(Cc2nc(C3CN(C(=O)c4cnn(Cc5ccccc5)c4)CC34CN(C)C4)n[nH]2)cc1Cl |
| InChI | InChI=1S/C28H30ClN7O.C6H10O/c1-19-8-9-21(10-24(19)29)11-25-31-26(33-32-25)23-15-35(18-28(23)16-34(2)17-28)27(37)22-12-30-36(14-22)13-20-6-4-3-5-7-20;1-6(2)3-5(6)4-7/h3-10,12,14,23H,11,13,15-18H2,1-2H3,(H,31,32,33);4-5H,3H2,1-2H3 |
| InChIKey | SPGOJDJABVZTMO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.19 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|