C20H27N7O3S — CID 170756321
[(1S)-2,2-dimethylcyclopropyl]-[5-[5-(1-hydrazinylethyl)-1,2,4-oxadiazol-3-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]methanone (PubChem CID 170756321) has the molecular formula C20H27N7O3S and a molecular weight of 445.55 g/mol. Its IUPAC name is [(1S)-2,2-dimethylcyclopropyl]-[5-[5-(1-hydrazinylethyl)-1,2,4-oxadiazol-3-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]methanone.
| Compound Name | [(1S)-2,2-dimethylcyclopropyl]-[5-[5-(1-hydrazinylethyl)-1,2,4-oxadiazol-3-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]methanone |
|---|---|
| PubChem CID | 170756321 |
| Molecular Formula | C20H27N7O3S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [(1S)-2,2-dimethylcyclopropyl]-[5-[5-(1-hydrazinylethyl)-1,2,4-oxadiazol-3-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]methanone |
| SMILES | CC(NN)c1nc(C2CN(C(=O)c3cncs3)CC23CN(C(=O)[C@H]2CC2(C)C)C3)no1 |
| InChI | InChI=1S/C20H27N7O3S/c1-11(24-21)16-23-15(25-30-16)13-6-26(18(29)14-5-22-10-31-14)7-20(13)8-27(9-20)17(28)12-4-19(12,2)3/h5,10-13,24H,4,6-9,21H2,1-3H3/t11?,12-,13?/m1/s1 |
| InChIKey | COTYNGQCFCKBNF-OTTFEQOBSA-N |
| XLogP | 1.16 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|