C20H28F3NO4 — CID 170758480
2-[4-(1-acetylpiperidin-4-yl)-2-(trifluoromethyl)phenoxy]-2-methylpropanoic acid;ethane (PubChem CID 170758480) has the molecular formula C20H28F3NO4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-[4-(1-acetylpiperidin-4-yl)-2-(trifluoromethyl)phenoxy]-2-methylpropanoic acid;ethane.
| Compound Name | 2-[4-(1-acetylpiperidin-4-yl)-2-(trifluoromethyl)phenoxy]-2-methylpropanoic acid;ethane |
|---|---|
| PubChem CID | 170758480 |
| Molecular Formula | C20H28F3NO4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[4-(1-acetylpiperidin-4-yl)-2-(trifluoromethyl)phenoxy]-2-methylpropanoic acid;ethane |
| SMILES | CC.CC(=O)N1CCC(c2ccc(OC(C)(C)C(=O)O)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H22F3NO4.C2H6/c1-11(23)22-8-6-12(7-9-22)13-4-5-15(14(10-13)18(19,20)21)26-17(2,3)16(24)25;1-2/h4-5,10,12H,6-9H2,1-3H3,(H,24,25);1-2H3 |
| InChIKey | OLLTZHMMOVQRBB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |