C10H11F3N2 — CID 170761780
2,6-difluoro-4-[(3S)-3-fluoropyrrolidin-1-yl]aniline (PubChem CID 170761780) has the molecular formula C10H11F3N2 and a molecular weight of 216.21 g/mol. Its IUPAC name is 2,6-difluoro-4-[(3S)-3-fluoropyrrolidin-1-yl]aniline.
| Compound Name | 2,6-difluoro-4-[(3S)-3-fluoropyrrolidin-1-yl]aniline |
|---|---|
| PubChem CID | 170761780 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2,6-difluoro-4-[(3S)-3-fluoropyrrolidin-1-yl]aniline |
| SMILES | Nc1c(F)cc(N2CC[C@H](F)C2)cc1F |
| InChI | InChI=1S/C10H11F3N2/c11-6-1-2-15(5-6)7-3-8(12)10(14)9(13)4-7/h3-4,6H,1-2,5,14H2/t6-/m0/s1 |
| InChIKey | JDTNNRAIUIESRZ-LURJTMIESA-N |
| XLogP | 2.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|