C19H20F2N4O — CID 170762975
2-[4-[[5-(2-cyclopropylethynyl)-2-methylphenyl]-difluoromethyl]triazol-1-yl]-N,N-dimethylacetamide (PubChem CID 170762975) has the molecular formula C19H20F2N4O and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[4-[[5-(2-cyclopropylethynyl)-2-methylphenyl]-difluoromethyl]triazol-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[[5-(2-cyclopropylethynyl)-2-methylphenyl]-difluoromethyl]triazol-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 170762975 |
| Molecular Formula | C19H20F2N4O |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[4-[[5-(2-cyclopropylethynyl)-2-methylphenyl]-difluoromethyl]triazol-1-yl]-N,N-dimethylacetamide |
| SMILES | Cc1ccc(C#CC2CC2)cc1C(F)(F)c1cn(CC(=O)N(C)C)nn1 |
| InChI | InChI=1S/C19H20F2N4O/c1-13-4-5-15(9-8-14-6-7-14)10-16(13)19(20,21)17-11-25(23-22-17)12-18(26)24(2)3/h4-5,10-11,14H,6-7,12H2,1-3H3 |
| InChIKey | MNWZUCZBKNGVTP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|