C18H16N4S — CID 170762910
4-[[4-[4-(2-cyclopropylethynyl)-2-methylphenyl]triazol-1-yl]methyl]-1,3-thiazole (PubChem CID 170762910) has the molecular formula C18H16N4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 4-[[4-[4-(2-cyclopropylethynyl)-2-methylphenyl]triazol-1-yl]methyl]-1,3-thiazole.
| Compound Name | 4-[[4-[4-(2-cyclopropylethynyl)-2-methylphenyl]triazol-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 170762910 |
| Molecular Formula | C18H16N4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-[[4-[4-(2-cyclopropylethynyl)-2-methylphenyl]triazol-1-yl]methyl]-1,3-thiazole |
| SMILES | Cc1cc(C#CC2CC2)ccc1-c1cn(Cc2cscn2)nn1 |
| InChI | InChI=1S/C18H16N4S/c1-13-8-15(5-4-14-2-3-14)6-7-17(13)18-10-22(21-20-18)9-16-11-23-12-19-16/h6-8,10-12,14H,2-3,9H2,1H3 |
| InChIKey | FEMSASMECHFGEM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|