C25H28N4O — CID 164857089
N-benzyl-3-[3-methyl-4-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]phenyl]prop-2-yn-1-amine (PubChem CID 164857089) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is N-benzyl-3-[3-methyl-4-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]phenyl]prop-2-yn-1-amine.
| Compound Name | N-benzyl-3-[3-methyl-4-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 164857089 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-benzyl-3-[3-methyl-4-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]phenyl]prop-2-yn-1-amine |
| SMILES | Cc1cc(C#CCNCc2ccccc2)ccc1-c1cn(C[C@H]2CCCCO2)nn1 |
| InChI | InChI=1S/C25H28N4O/c1-20-16-21(10-7-14-26-17-22-8-3-2-4-9-22)12-13-24(20)25-19-29(28-27-25)18-23-11-5-6-15-30-23/h2-4,8-9,12-13,16,19,23,26H,5-6,11,14-15,17-18H2,1H3/t23-/m1/s1 |
| InChIKey | RJEYVLXWQFKGLF-HSZRJFAPSA-N |
| XLogP | 3.96 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|