C21H25N3O2 — CID 164857944
4-[4-(2-cyclopropylethynyl)-2-(methoxymethyl)phenyl]-1-[[(2R)-oxan-2-yl]methyl]triazole (PubChem CID 164857944) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[4-(2-cyclopropylethynyl)-2-(methoxymethyl)phenyl]-1-[[(2R)-oxan-2-yl]methyl]triazole.
| Compound Name | 4-[4-(2-cyclopropylethynyl)-2-(methoxymethyl)phenyl]-1-[[(2R)-oxan-2-yl]methyl]triazole |
|---|---|
| PubChem CID | 164857944 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[4-(2-cyclopropylethynyl)-2-(methoxymethyl)phenyl]-1-[[(2R)-oxan-2-yl]methyl]triazole |
| SMILES | COCc1cc(C#CC2CC2)ccc1-c1cn(C[C@H]2CCCCO2)nn1 |
| InChI | InChI=1S/C21H25N3O2/c1-25-15-18-12-17(8-7-16-5-6-16)9-10-20(18)21-14-24(23-22-21)13-19-4-2-3-11-26-19/h9-10,12,14,16,19H,2-6,11,13,15H2,1H3/t19-/m1/s1 |
| InChIKey | CKYVFBQVULQALL-LJQANCHMSA-N |
| XLogP | 3.42 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|