C23H30N4O3 — CID 164857042
tert-butyl N-[3-[3-methyl-4-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]phenyl]prop-2-ynyl]carbamate (PubChem CID 164857042) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is tert-butyl N-[3-[3-methyl-4-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]phenyl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-methyl-4-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]phenyl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 164857042 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | tert-butyl N-[3-[3-methyl-4-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]phenyl]prop-2-ynyl]carbamate |
| SMILES | Cc1cc(C#CCNC(=O)OC(C)(C)C)ccc1-c1cn(C[C@H]2CCCCO2)nn1 |
| InChI | InChI=1S/C23H30N4O3/c1-17-14-18(8-7-12-24-22(28)30-23(2,3)4)10-11-20(17)21-16-27(26-25-21)15-19-9-5-6-13-29-19/h10-11,14,16,19H,5-6,9,12-13,15H2,1-4H3,(H,24,28)/t19-/m1/s1 |
| InChIKey | CRUZUFNZVWLDRI-LJQANCHMSA-N |
| XLogP | 3.70 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|