C25H29N5O — CID 164856997
5-(3-anilinoprop-1-ynyl)-N,N-dimethyl-2-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]aniline (PubChem CID 164856997) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 5-(3-anilinoprop-1-ynyl)-N,N-dimethyl-2-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]aniline.
| Compound Name | 5-(3-anilinoprop-1-ynyl)-N,N-dimethyl-2-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]aniline |
|---|---|
| PubChem CID | 164856997 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 5-(3-anilinoprop-1-ynyl)-N,N-dimethyl-2-[1-[[(2R)-oxan-2-yl]methyl]triazol-4-yl]aniline |
| SMILES | CN(C)c1cc(C#CCNc2ccccc2)ccc1-c1cn(C[C@H]2CCCCO2)nn1 |
| InChI | InChI=1S/C25H29N5O/c1-29(2)25-17-20(9-8-15-26-21-10-4-3-5-11-21)13-14-23(25)24-19-30(28-27-24)18-22-12-6-7-16-31-22/h3-5,10-11,13-14,17,19,22,26H,6-7,12,15-16,18H2,1-2H3/t22-/m1/s1 |
| InChIKey | DERCMIUWXBEYGP-JOCHJYFZSA-N |
| XLogP | 4.04 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|