C19H23N3O4S — CID 164858406
3-[3-methyl-4-[1-(oxan-2-ylmethyl)triazol-4-yl]phenyl]prop-2-ynyl methanesulfonate (PubChem CID 164858406) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 3-[3-methyl-4-[1-(oxan-2-ylmethyl)triazol-4-yl]phenyl]prop-2-ynyl methanesulfonate.
| Compound Name | 3-[3-methyl-4-[1-(oxan-2-ylmethyl)triazol-4-yl]phenyl]prop-2-ynyl methanesulfonate |
|---|---|
| PubChem CID | 164858406 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-[3-methyl-4-[1-(oxan-2-ylmethyl)triazol-4-yl]phenyl]prop-2-ynyl methanesulfonate |
| SMILES | Cc1cc(C#CCOS(C)(=O)=O)ccc1-c1cn(CC2CCCCO2)nn1 |
| InChI | InChI=1S/C19H23N3O4S/c1-15-12-16(6-5-11-26-27(2,23)24)8-9-18(15)19-14-22(21-20-19)13-17-7-3-4-10-25-17/h8-9,12,14,17H,3-4,7,10-11,13H2,1-2H3 |
| InChIKey | MGZARIPMWAIVES-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|