C20H24N4O — CID 164857428
4-(2-cyclopropylethynyl)-2-[1-[1-(oxan-2-ylmethyl)triazol-4-yl]ethyl]pyridine (PubChem CID 164857428) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-(2-cyclopropylethynyl)-2-[1-[1-(oxan-2-ylmethyl)triazol-4-yl]ethyl]pyridine.
| Compound Name | 4-(2-cyclopropylethynyl)-2-[1-[1-(oxan-2-ylmethyl)triazol-4-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 164857428 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-(2-cyclopropylethynyl)-2-[1-[1-(oxan-2-ylmethyl)triazol-4-yl]ethyl]pyridine |
| SMILES | CC(c1cc(C#CC2CC2)ccn1)c1cn(CC2CCCCO2)nn1 |
| InChI | InChI=1S/C20H24N4O/c1-15(19-12-17(9-10-21-19)8-7-16-5-6-16)20-14-24(23-22-20)13-18-4-2-3-11-25-18/h9-10,12,14-16,18H,2-6,11,13H2,1H3 |
| InChIKey | VMKUWVWCOVWSDC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|