C20H23N3O — CID 164858228
4-[4-(2-cyclopropylethynyl)phenyl]-5-methyl-1-[[(2R)-oxan-2-yl]methyl]triazole (PubChem CID 164858228) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[4-(2-cyclopropylethynyl)phenyl]-5-methyl-1-[[(2R)-oxan-2-yl]methyl]triazole.
| Compound Name | 4-[4-(2-cyclopropylethynyl)phenyl]-5-methyl-1-[[(2R)-oxan-2-yl]methyl]triazole |
|---|---|
| PubChem CID | 164858228 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-[4-(2-cyclopropylethynyl)phenyl]-5-methyl-1-[[(2R)-oxan-2-yl]methyl]triazole |
| SMILES | Cc1c(-c2ccc(C#CC3CC3)cc2)nnn1C[C@H]1CCCCO1 |
| InChI | InChI=1S/C20H23N3O/c1-15-20(21-22-23(15)14-19-4-2-3-13-24-19)18-11-9-17(10-12-18)8-7-16-5-6-16/h9-12,16,19H,2-6,13-14H2,1H3/t19-/m1/s1 |
| InChIKey | YZLZUEJXXDSCEO-LJQANCHMSA-N |
| XLogP | 3.58 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|