C16H21BN4O — CID 164857434
CID 164857434 (PubChem CID 164857434) has the molecular formula C16H21BN4O and a molecular weight of 296.18 g/mol.
| Compound Name | CID 164857434 |
|---|---|
| PubChem CID | 164857434 |
| Molecular Formula | C16H21BN4O |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(-c2cn(CC3CCCCO3)nn2)c(C(C)C)c1 |
| InChI | InChI=1S/C16H21BN4O/c1-11(2)14-7-12(17)8-18-16(14)15-10-21(20-19-15)9-13-5-3-4-6-22-13/h7-8,10-11,13H,3-6,9H2,1-2H3 |
| InChIKey | OHJGBQJYBFOIRM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|