C26H34N4O — CID 164857809
N-benzyl-3-[4-methyl-3-[3-methyl-1-[[(2R)-oxan-2-yl]methyl]-2H-triazol-4-yl]phenyl]prop-2-yn-1-amine;molecular hydrogen (PubChem CID 164857809) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is N-benzyl-3-[4-methyl-3-[3-methyl-1-[[(2R)-oxan-2-yl]methyl]-2H-triazol-4-yl]phenyl]prop-2-yn-1-amine;molecular hydrogen.
| Compound Name | N-benzyl-3-[4-methyl-3-[3-methyl-1-[[(2R)-oxan-2-yl]methyl]-2H-triazol-4-yl]phenyl]prop-2-yn-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 164857809 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | N-benzyl-3-[4-methyl-3-[3-methyl-1-[[(2R)-oxan-2-yl]methyl]-2H-triazol-4-yl]phenyl]prop-2-yn-1-amine;molecular hydrogen |
| SMILES | Cc1ccc(C#CCNCc2ccccc2)cc1C1=CN(C[C@H]2CCCCO2)NN1C.[H][H] |
| InChI | InChI=1S/C26H32N4O.H2/c1-21-13-14-22(11-8-15-27-18-23-9-4-3-5-10-23)17-25(21)26-20-30(28-29(26)2)19-24-12-6-7-16-31-24;/h3-5,9-10,13-14,17,20,24,27-28H,6-7,12,15-16,18-19H2,1-2H3;1H/t24-;/m1./s1 |
| InChIKey | KIMFDZOGJAFYBF-GJFSDDNBSA-N |
| XLogP | 3.92 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|