C21H31N3O — CID 164857924
(Z)-1-[2-methyl-4-[3-(propan-2-ylamino)prop-1-ynyl]phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine (PubChem CID 164857924) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is (Z)-1-[2-methyl-4-[3-(propan-2-ylamino)prop-1-ynyl]phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine.
| Compound Name | (Z)-1-[2-methyl-4-[3-(propan-2-ylamino)prop-1-ynyl]phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 164857924 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | (Z)-1-[2-methyl-4-[3-(propan-2-ylamino)prop-1-ynyl]phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
| SMILES | Cc1cc(C#CCNC(C)C)ccc1/C(N)=C/NCC1CCCCO1 |
| InChI | InChI=1S/C21H31N3O/c1-16(2)24-11-6-7-18-9-10-20(17(3)13-18)21(22)15-23-14-19-8-4-5-12-25-19/h9-10,13,15-16,19,23-24H,4-5,8,11-12,14,22H2,1-3H3/b21-15- |
| InChIKey | QYIVRYIRZREJNO-QNGOZBTKSA-N |
| XLogP | 2.76 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|