C21H32N4O — CID 164857557
(Z)-1-[4-(2,5-diazaspiro[3.4]octan-2-yl)-2-methylphenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine (PubChem CID 164857557) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is (Z)-1-[4-(2,5-diazaspiro[3.4]octan-2-yl)-2-methylphenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine.
| Compound Name | (Z)-1-[4-(2,5-diazaspiro[3.4]octan-2-yl)-2-methylphenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 164857557 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (Z)-1-[4-(2,5-diazaspiro[3.4]octan-2-yl)-2-methylphenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
| SMILES | Cc1cc(N2CC3(CCCN3)C2)ccc1/C(N)=C/NCC1CCCCO1 |
| InChI | InChI=1S/C21H32N4O/c1-16-11-17(25-14-21(15-25)8-4-9-24-21)6-7-19(16)20(22)13-23-12-18-5-2-3-10-26-18/h6-7,11,13,18,23-24H,2-5,8-10,12,14-15,22H2,1H3/b20-13- |
| InChIKey | MUUXUAMMASOBTF-MOSHPQCFSA-N |
| XLogP | 2.35 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|